C11H15N3O2S — CID 122147631
5-(2-methylpiperazine-1-carbonyl)thiophene-2-carboxamide (PubChem CID 122147631) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 5-(2-methylpiperazine-1-carbonyl)thiophene-2-carboxamide.
| Compound Name | 5-(2-methylpiperazine-1-carbonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122147631 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 5-(2-methylpiperazine-1-carbonyl)thiophene-2-carboxamide |
| SMILES | CC1CNCCN1C(=O)c1ccc(C(N)=O)s1 |
| InChI | InChI=1S/C11H15N3O2S/c1-7-6-13-4-5-14(7)11(16)9-3-2-8(17-9)10(12)15/h2-3,7,13H,4-6H2,1H3,(H2,12,15) |
| InChIKey | YJBYQGSENHBDBF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |