About N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide
N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide (PubChem CID 122148046) has the molecular formula C12H15F3N2O3S
and a molecular weight of 324.32 g/mol. Its IUPAC name is N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide.
Molecular Properties
| Compound Name | N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide |
| PubChem CID | 122148046 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)C1CN(CC(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-12(14,15)11(18)8-17-6-10(7-17)21(19,20)16-9-4-2-1-3-5-9/h1-5,10-11,16,18H,6-8H2 |
| InChIKey | UPBMRCNENVNIOX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide?
The IUPAC name of N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide (CID 122148046) is N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide.
What is the SMILES notation for N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide?
The canonical SMILES for N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide is O=S(=O)(Nc1ccccc1)C1CN(CC(O)C(F)(F)F)C1.
What is the InChIKey of N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide?
The InChIKey is UPBMRCNENVNIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O3S/c13-12(14,15)11(18)8-17-6-10(7-17)21(19,20)16-9-4-2-1-3-5-9/h1-5,10-11,16,18H,6-8H2.
What are the key properties of N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide?
N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide has a molecular weight of 324.32 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)azetidine-3-sulfonamide is sourced from PubChem (CID 122148046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).