C16H17N3O3S — CID 122148571
5-[2-[6-(2-methoxyethoxy)-3-pyridinyl]-1,3-thiazol-4-yl]-2,4-dimethyl-1,3-oxazole (PubChem CID 122148571) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 5-[2-[6-(2-methoxyethoxy)-3-pyridinyl]-1,3-thiazol-4-yl]-2,4-dimethyl-1,3-oxazole.
| Compound Name | 5-[2-[6-(2-methoxyethoxy)-3-pyridinyl]-1,3-thiazol-4-yl]-2,4-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 122148571 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-[2-[6-(2-methoxyethoxy)-3-pyridinyl]-1,3-thiazol-4-yl]-2,4-dimethyl-1,3-oxazole |
| SMILES | COCCOc1ccc(-c2nc(-c3oc(C)nc3C)cs2)cn1 |
| InChI | InChI=1S/C16H17N3O3S/c1-10-15(22-11(2)18-10)13-9-23-16(19-13)12-4-5-14(17-8-12)21-7-6-20-3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | OCOLLRQELLFUAV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|