C11H7Cl3N2O3 — CID 122149844
2,3,5-trichloro-6-hydroxy-N-(1,2-oxazol-5-ylmethyl)benzamide (PubChem CID 122149844) has the molecular formula C11H7Cl3N2O3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-(1,2-oxazol-5-ylmethyl)benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-(1,2-oxazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 122149844 |
| Molecular Formula | C11H7Cl3N2O3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-(1,2-oxazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccno1)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl3N2O3/c12-6-3-7(13)10(17)8(9(6)14)11(18)15-4-5-1-2-16-19-5/h1-3,17H,4H2,(H,15,18) |
| InChIKey | BWMRPNCOBLEWPZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|