C16H22N4O4 — CID 122150088
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-methyl-4-propan-2-yloxyphenyl)urea (PubChem CID 122150088) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-methyl-4-propan-2-yloxyphenyl)urea.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-methyl-4-propan-2-yloxyphenyl)urea |
|---|---|
| PubChem CID | 122150088 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(3-methyl-4-propan-2-yloxyphenyl)urea |
| SMILES | Cc1cc(NC(=O)NCCN2C(=O)CNC2=O)ccc1OC(C)C |
| InChI | InChI=1S/C16H22N4O4/c1-10(2)24-13-5-4-12(8-11(13)3)19-15(22)17-6-7-20-14(21)9-18-16(20)23/h4-5,8,10H,6-7,9H2,1-3H3,(H,18,23)(H2,17,19,22) |
| InChIKey | GKXNTFRTAXLWCV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|