C13H14N4O4S — CID 122151055
N,3-dimethyl-N-(6-methylpyridazin-3-yl)-4-nitrobenzenesulfonamide (PubChem CID 122151055) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is N,3-dimethyl-N-(6-methylpyridazin-3-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N,3-dimethyl-N-(6-methylpyridazin-3-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122151055 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N,3-dimethyl-N-(6-methylpyridazin-3-yl)-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2ccc([N+](=O)[O-])c(C)c2)nn1 |
| InChI | InChI=1S/C13H14N4O4S/c1-9-8-11(5-6-12(9)17(18)19)22(20,21)16(3)13-7-4-10(2)14-15-13/h4-8H,1-3H3 |
| InChIKey | JPKQTQOWQYCUMG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|