About 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide
2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide (PubChem CID 122151720) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide |
| PubChem CID | 122151720 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide |
| SMILES | C#CC(C)NC(=O)C1=CC(C)C=C(C(=O)NC(C)C#C)O1 |
| InChI | InChI=1S/C16H18N2O3/c1-6-11(4)17-15(19)13-8-10(3)9-14(21-13)16(20)18-12(5)7-2/h1-2,8-12H,3-5H3,(H,17,19)(H,18,20) |
| InChIKey | LVDTYOJYDWVEGF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide?
The IUPAC name of 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide (CID 122151720) is 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide.
What is the SMILES notation for 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide?
The canonical SMILES for 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide is C#CC(C)NC(=O)C1=CC(C)C=C(C(=O)NC(C)C#C)O1.
What is the InChIKey of 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide?
The InChIKey is LVDTYOJYDWVEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-6-11(4)17-15(19)13-8-10(3)9-14(21-13)16(20)18-12(5)7-2/h1-2,8-12H,3-5H3,(H,17,19)(H,18,20).
What are the key properties of 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide?
2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide has a molecular weight of 286.33 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-bis(but-3-yn-2-yl)-4-methyl-4H-pyran-2,6-dicarboxamide is sourced from PubChem (CID 122151720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).