C13H14ClF4NO2 — CID 122151805
2-chloro-4-fluoro-N-[1-(2,2,2-trifluoroethoxy)butan-2-yl]benzamide (PubChem CID 122151805) has the molecular formula C13H14ClF4NO2 and a molecular weight of 327.71 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[1-(2,2,2-trifluoroethoxy)butan-2-yl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[1-(2,2,2-trifluoroethoxy)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 122151805 |
| Molecular Formula | C13H14ClF4NO2 |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-chloro-4-fluoro-N-[1-(2,2,2-trifluoroethoxy)butan-2-yl]benzamide |
| SMILES | CCC(COCC(F)(F)F)NC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H14ClF4NO2/c1-2-9(6-21-7-13(16,17)18)19-12(20)10-4-3-8(15)5-11(10)14/h3-5,9H,2,6-7H2,1H3,(H,19,20) |
| InChIKey | QAZOGZCODSWXJT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |