C11H12BrF4NO2 — CID 122152687
2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 122152687) has the molecular formula C11H12BrF4NO2 and a molecular weight of 346.12 g/mol. Its IUPAC name is 2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 122152687 |
| Molecular Formula | C11H12BrF4NO2 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)Cc1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C11H12BrF4NO2/c12-7-10(15)8(13)6(9(14)11(7)16)5-17(1-3-18)2-4-19/h18-19H,1-5H2 |
| InChIKey | STJOECRTHUGSPW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|