About N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide
N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide (PubChem CID 122152905) has the molecular formula C17H20FN3O2
and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide.
Molecular Properties
| Compound Name | N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide |
| PubChem CID | 122152905 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide |
| SMILES | CC(CC(=O)N(C)Cc1noc(C2CC2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O2/c1-11(12-5-7-14(18)8-6-12)9-16(22)21(2)10-15-19-17(23-20-15)13-3-4-13/h5-8,11,13H,3-4,9-10H2,1-2H3 |
| InChIKey | WPNNRRBNXQNVCJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide?
The IUPAC name of N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide (CID 122152905) is N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide.
What is the SMILES notation for N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide?
The canonical SMILES for N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide is CC(CC(=O)N(C)Cc1noc(C2CC2)n1)c1ccc(F)cc1.
What is the InChIKey of N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide?
The InChIKey is WPNNRRBNXQNVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O2/c1-11(12-5-7-14(18)8-6-12)9-16(22)21(2)10-15-19-17(23-20-15)13-3-4-13/h5-8,11,13H,3-4,9-10H2,1-2H3.
What are the key properties of N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide?
N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide has a molecular weight of 317.36 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-3-(4-fluorophenyl)-N-methylbutanamide is sourced from PubChem (CID 122152905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).