About 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol
4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol (PubChem CID 122152921) has the molecular formula C17H24N4O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol |
| PubChem CID | 122152921 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol |
| SMILES | Cc1cccc(C)c1OCCCn1nnnc1C1(O)CCOCC1 |
| InChI | InChI=1S/C17H24N4O3/c1-13-5-3-6-14(2)15(13)24-10-4-9-21-16(18-19-20-21)17(22)7-11-23-12-8-17/h3,5-6,22H,4,7-12H2,1-2H3 |
| InChIKey | BJHVVKDEFDFPHZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol?
The IUPAC name of 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol (CID 122152921) is 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol.
What is the SMILES notation for 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol?
The canonical SMILES for 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol is Cc1cccc(C)c1OCCCn1nnnc1C1(O)CCOCC1.
What is the InChIKey of 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol?
The InChIKey is BJHVVKDEFDFPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O3/c1-13-5-3-6-14(2)15(13)24-10-4-9-21-16(18-19-20-21)17(22)7-11-23-12-8-17/h3,5-6,22H,4,7-12H2,1-2H3.
What are the key properties of 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol?
4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol has a molecular weight of 332.40 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[3-(2,6-dimethylphenoxy)propyl]tetrazol-5-yl]oxan-4-ol is sourced from PubChem (CID 122152921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).