About (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone
(2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone (PubChem CID 122153399) has the molecular formula C16H18FN3O2
and a molecular weight of 303.34 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone |
| PubChem CID | 122153399 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCC(F)(c3ccccn3)CC2)c(C)o1 |
| InChI | InChI=1S/C16H18FN3O2/c1-11-14(19-12(2)22-11)15(21)20-9-6-16(17,7-10-20)13-5-3-4-8-18-13/h3-5,8H,6-7,9-10H2,1-2H3 |
| InChIKey | SOELSKAIYZLEOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone?
The IUPAC name of (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone (CID 122153399) is (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone.
What is the SMILES notation for (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone?
The canonical SMILES for (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone is Cc1nc(C(=O)N2CCC(F)(c3ccccn3)CC2)c(C)o1.
What is the InChIKey of (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone?
The InChIKey is SOELSKAIYZLEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FN3O2/c1-11-14(19-12(2)22-11)15(21)20-9-6-16(17,7-10-20)13-5-3-4-8-18-13/h3-5,8H,6-7,9-10H2,1-2H3.
What are the key properties of (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone?
(2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone has a molecular weight of 303.34 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethyl-1,3-oxazol-4-yl)-(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methanone is sourced from PubChem (CID 122153399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).