About 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide
4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide (PubChem CID 122153417) has the molecular formula C17H26N2O4
and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide |
| PubChem CID | 122153417 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cc(=O)cc(C(=O)NCCCCC)o1 |
| InChI | InChI=1S/C17H26N2O4/c1-3-5-7-9-18-16(21)14-11-13(20)12-15(23-14)17(22)19-10-8-6-4-2/h11-12H,3-10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | HOMMFEGZLGSLMD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide?
The IUPAC name of 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide (CID 122153417) is 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide.
What is the SMILES notation for 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide?
The canonical SMILES for 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide is CCCCCNC(=O)c1cc(=O)cc(C(=O)NCCCCC)o1.
What is the InChIKey of 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide?
The InChIKey is HOMMFEGZLGSLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-3-5-7-9-18-16(21)14-11-13(20)12-15(23-14)17(22)19-10-8-6-4-2/h11-12H,3-10H2,1-2H3,(H,18,21)(H,19,22).
What are the key properties of 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide?
4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide has a molecular weight of 322.41 g/mol, XLogP of 2.48, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2-N,6-N-dipentylpyran-2,6-dicarboxamide is sourced from PubChem (CID 122153417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).