C17H26N2O4 — CID 122153419
2-N,6-N-bis(2,2-dimethylpropyl)-4-oxopyran-2,6-dicarboxamide (PubChem CID 122153419) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-N,6-N-bis(2,2-dimethylpropyl)-4-oxopyran-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(2,2-dimethylpropyl)-4-oxopyran-2,6-dicarboxamide |
|---|---|
| PubChem CID | 122153419 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-N,6-N-bis(2,2-dimethylpropyl)-4-oxopyran-2,6-dicarboxamide |
| SMILES | CC(C)(C)CNC(=O)c1cc(=O)cc(C(=O)NCC(C)(C)C)o1 |
| InChI | InChI=1S/C17H26N2O4/c1-16(2,3)9-18-14(21)12-7-11(20)8-13(23-12)15(22)19-10-17(4,5)6/h7-8H,9-10H2,1-6H3,(H,18,21)(H,19,22) |
| InChIKey | GGWWKBXVVJWKJL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |