About 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole
5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole (PubChem CID 122154069) has the molecular formula C11H13N5O
and a molecular weight of 231.26 g/mol. Its IUPAC name is 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole |
| PubChem CID | 122154069 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole |
| SMILES | CCOc1cc(N2Cc3cn[nH]c3C2)ncn1 |
| InChI | InChI=1S/C11H13N5O/c1-2-17-11-3-10(12-7-13-11)16-5-8-4-14-15-9(8)6-16/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | HKBWZPSNMJBHMT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The IUPAC name of 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole (CID 122154069) is 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole.
What is the SMILES notation for 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The canonical SMILES for 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole is CCOc1cc(N2Cc3cn[nH]c3C2)ncn1.
What is the InChIKey of 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The InChIKey is HKBWZPSNMJBHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O/c1-2-17-11-3-10(12-7-13-11)16-5-8-4-14-15-9(8)6-16/h3-4,7H,2,5-6H2,1H3,(H,14,15).
What are the key properties of 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole has a molecular weight of 231.26 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-ethoxypyrimidin-4-yl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 122154069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).