C19H24N2O4 — CID 122154559
3-[2-[2-(furan-2-yl)-2-hydroxyethyl]pyrrolidin-1-yl]-2-hydroxy-2-phenylpropanamide (PubChem CID 122154559) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[2-[2-(furan-2-yl)-2-hydroxyethyl]pyrrolidin-1-yl]-2-hydroxy-2-phenylpropanamide.
| Compound Name | 3-[2-[2-(furan-2-yl)-2-hydroxyethyl]pyrrolidin-1-yl]-2-hydroxy-2-phenylpropanamide |
|---|---|
| PubChem CID | 122154559 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[2-[2-(furan-2-yl)-2-hydroxyethyl]pyrrolidin-1-yl]-2-hydroxy-2-phenylpropanamide |
| SMILES | NC(=O)C(O)(CN1CCCC1CC(O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O4/c20-18(23)19(24,14-6-2-1-3-7-14)13-21-10-4-8-15(21)12-16(22)17-9-5-11-25-17/h1-3,5-7,9,11,15-16,22,24H,4,8,10,12-13H2,(H2,20,23) |
| InChIKey | RDZFNDTVZKYFQD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |