About 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine
2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine (PubChem CID 122154681) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine |
| PubChem CID | 122154681 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine |
| SMILES | COCC1CN(c2ncnc3scnc23)CCO1 |
| InChI | InChI=1S/C11H14N4O2S/c1-16-5-8-4-15(2-3-17-8)10-9-11(13-6-12-10)18-7-14-9/h6-8H,2-5H2,1H3 |
| InChIKey | GQMOXHSYZKKVRM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine?
The IUPAC name of 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine (CID 122154681) is 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine.
What is the SMILES notation for 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine?
The canonical SMILES for 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine is COCC1CN(c2ncnc3scnc23)CCO1.
What is the InChIKey of 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine?
The InChIKey is GQMOXHSYZKKVRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c1-16-5-8-4-15(2-3-17-8)10-9-11(13-6-12-10)18-7-14-9/h6-8H,2-5H2,1H3.
What are the key properties of 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine?
2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine has a molecular weight of 266.33 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-4-([1,3]thiazolo[5,4-d]pyrimidin-7-yl)morpholine is sourced from PubChem (CID 122154681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).