C20H25N3O2 — CID 122154696
[4-[(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-ylamino)methyl]oxan-4-yl]methanol (PubChem CID 122154696) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [4-[(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-ylamino)methyl]oxan-4-yl]methanol.
| Compound Name | [4-[(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-ylamino)methyl]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 122154696 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [4-[(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-ylamino)methyl]oxan-4-yl]methanol |
| SMILES | OCC1(CNc2cc3c(nn2)-c2ccccc2CCC3)CCOCC1 |
| InChI | InChI=1S/C20H25N3O2/c24-14-20(8-10-25-11-9-20)13-21-18-12-16-6-3-5-15-4-1-2-7-17(15)19(16)23-22-18/h1-2,4,7,12,24H,3,5-6,8-11,13-14H2,(H,21,22) |
| InChIKey | SBWASCHQMOEDLD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |