About 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine
4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine (PubChem CID 122154731) has the molecular formula C8H8N4S2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine |
| PubChem CID | 122154731 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine |
| SMILES | Nc1snnc1-c1nc(C2CC2)cs1 |
| InChI | InChI=1S/C8H8N4S2/c9-7-6(11-12-14-7)8-10-5(3-13-8)4-1-2-4/h3-4H,1-2,9H2 |
| InChIKey | VLZSLVAUXPBCDE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine?
The IUPAC name of 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine (CID 122154731) is 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine.
What is the SMILES notation for 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine?
The canonical SMILES for 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine is Nc1snnc1-c1nc(C2CC2)cs1.
What is the InChIKey of 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine?
The InChIKey is VLZSLVAUXPBCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S2/c9-7-6(11-12-14-7)8-10-5(3-13-8)4-1-2-4/h3-4H,1-2,9H2.
What are the key properties of 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine?
4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine has a molecular weight of 224.31 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyclopropyl-1,3-thiazol-2-yl)thiadiazol-5-amine is sourced from PubChem (CID 122154731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).