C16H22N4OSi — CID 122154804
1-(pyridazin-3-ylmethyl)-3-[(4-trimethylsilylphenyl)methyl]urea (PubChem CID 122154804) has the molecular formula C16H22N4OSi and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-(pyridazin-3-ylmethyl)-3-[(4-trimethylsilylphenyl)methyl]urea.
| Compound Name | 1-(pyridazin-3-ylmethyl)-3-[(4-trimethylsilylphenyl)methyl]urea |
|---|---|
| PubChem CID | 122154804 |
| Molecular Formula | C16H22N4OSi |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(pyridazin-3-ylmethyl)-3-[(4-trimethylsilylphenyl)methyl]urea |
| SMILES | C[Si](C)(C)c1ccc(CNC(=O)NCc2cccnn2)cc1 |
| InChI | InChI=1S/C16H22N4OSi/c1-22(2,3)15-8-6-13(7-9-15)11-17-16(21)18-12-14-5-4-10-19-20-14/h4-10H,11-12H2,1-3H3,(H2,17,18,21) |
| InChIKey | RMLDSMWTRKCPCV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|