C17H26N2O4 — CID 122154833
(3S)-3-(hydroxymethyl)-N-(2-methyl-3-phenylmethoxypropyl)morpholine-4-carboxamide (PubChem CID 122154833) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is (3S)-3-(hydroxymethyl)-N-(2-methyl-3-phenylmethoxypropyl)morpholine-4-carboxamide.
| Compound Name | (3S)-3-(hydroxymethyl)-N-(2-methyl-3-phenylmethoxypropyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 122154833 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (3S)-3-(hydroxymethyl)-N-(2-methyl-3-phenylmethoxypropyl)morpholine-4-carboxamide |
| SMILES | CC(CNC(=O)N1CCOC[C@@H]1CO)COCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O4/c1-14(11-23-12-15-5-3-2-4-6-15)9-18-17(21)19-7-8-22-13-16(19)10-20/h2-6,14,16,20H,7-13H2,1H3,(H,18,21)/t14?,16-/m0/s1 |
| InChIKey | LSXDBOOSFWFKNS-WMCAAGNKSA-N |
| XLogP | 1.24 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |