About 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione
3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione (PubChem CID 122155053) has the molecular formula C15H18N2O4S
and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione |
| PubChem CID | 122155053 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C)c(=O)n(CCCS(=O)(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C15H18N2O4S/c1-12-11-16(2)15(19)17(14(12)18)9-6-10-22(20,21)13-7-4-3-5-8-13/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | NTXYDIBBACFJBB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione?
The IUPAC name of 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione (CID 122155053) is 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione is Cc1cn(C)c(=O)n(CCCS(=O)(=O)c2ccccc2)c1=O.
What is the InChIKey of 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione?
The InChIKey is NTXYDIBBACFJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4S/c1-12-11-16(2)15(19)17(14(12)18)9-6-10-22(20,21)13-7-4-3-5-8-13/h3-5,7-8,11H,6,9-10H2,1-2H3.
What are the key properties of 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione?
3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione has a molecular weight of 322.39 g/mol, XLogP of 0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(benzenesulfonyl)propyl]-1,5-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 122155053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).