About 4-(triazol-1-yl)azepane;dihydrochloride
4-(triazol-1-yl)azepane;dihydrochloride (PubChem CID 122155570) has the molecular formula C8H16Cl2N4
and a molecular weight of 239.15 g/mol. Its IUPAC name is 4-(triazol-1-yl)azepane;dihydrochloride.
Molecular Properties
| Compound Name | 4-(triazol-1-yl)azepane;dihydrochloride |
| PubChem CID | 122155570 |
| Molecular Formula | C8H16Cl2N4 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-(triazol-1-yl)azepane;dihydrochloride |
| SMILES | Cl.Cl.c1cn(C2CCCNCC2)nn1 |
| InChI | InChI=1S/C8H14N4.2ClH/c1-2-8(3-5-9-4-1)12-7-6-10-11-12;;/h6-9H,1-5H2;2*1H |
| InChIKey | JGCNQYQUCYCJMY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(triazol-1-yl)azepane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(triazol-1-yl)azepane;dihydrochloride?
The IUPAC name of 4-(triazol-1-yl)azepane;dihydrochloride (CID 122155570) is 4-(triazol-1-yl)azepane;dihydrochloride.
What is the SMILES notation for 4-(triazol-1-yl)azepane;dihydrochloride?
The canonical SMILES for 4-(triazol-1-yl)azepane;dihydrochloride is Cl.Cl.c1cn(C2CCCNCC2)nn1.
What is the InChIKey of 4-(triazol-1-yl)azepane;dihydrochloride?
The InChIKey is JGCNQYQUCYCJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4.2ClH/c1-2-8(3-5-9-4-1)12-7-6-10-11-12;;/h6-9H,1-5H2;2*1H.
What are the key properties of 4-(triazol-1-yl)azepane;dihydrochloride?
4-(triazol-1-yl)azepane;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(triazol-1-yl)azepane;dihydrochloride is sourced from PubChem (CID 122155570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).