About [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol
[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol (PubChem CID 122155892) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol.
Molecular Properties
| Compound Name | [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol |
| PubChem CID | 122155892 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol |
| SMILES | CCn1nccc1[C@@H]1OCCC[C@H]1CO |
| InChI | InChI=1S/C11H18N2O2/c1-2-13-10(5-6-12-13)11-9(8-14)4-3-7-15-11/h5-6,9,11,14H,2-4,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | SOGRBOCBSTUAKK-GXSJLCMTSA-N |
| XLogP | 1.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol?
The IUPAC name of [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol (CID 122155892) is [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol.
What is the SMILES notation for [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol?
The canonical SMILES for [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol is CCn1nccc1[C@@H]1OCCC[C@H]1CO.
What is the InChIKey of [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol?
The InChIKey is SOGRBOCBSTUAKK-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-2-13-10(5-6-12-13)11-9(8-14)4-3-7-15-11/h5-6,9,11,14H,2-4,7-8H2,1H3/t9-,11+/m0/s1.
What are the key properties of [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol?
[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol has a molecular weight of 210.28 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxan-3-yl]methanol is sourced from PubChem (CID 122155892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).