About 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole
4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole (PubChem CID 122155906) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole.
Molecular Properties
| Compound Name | 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole |
| PubChem CID | 122155906 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole |
| SMILES | CO[C@@H]1CNC[C@H]1c1cn[nH]n1 |
| InChI | InChI=1S/C7H12N4O/c1-12-7-4-8-2-5(7)6-3-9-11-10-6/h3,5,7-8H,2,4H2,1H3,(H,9,10,11)/t5-,7+/m0/s1 |
| InChIKey | GCICREJUOSGACW-CAHLUQPWSA-N |
| XLogP | -0.49 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole?
The IUPAC name of 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole (CID 122155906) is 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole.
What is the SMILES notation for 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole?
The canonical SMILES for 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole is CO[C@@H]1CNC[C@H]1c1cn[nH]n1.
What is the InChIKey of 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole?
The InChIKey is GCICREJUOSGACW-CAHLUQPWSA-N. The full InChI is InChI=1S/C7H12N4O/c1-12-7-4-8-2-5(7)6-3-9-11-10-6/h3,5,7-8H,2,4H2,1H3,(H,9,10,11)/t5-,7+/m0/s1.
What are the key properties of 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole?
4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole has a molecular weight of 168.20 g/mol, XLogP of -0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole is sourced from PubChem (CID 122155906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).