About (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone
(8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone (PubChem CID 122155919) has the molecular formula C18H19FN2O2S
and a molecular weight of 346.43 g/mol. Its IUPAC name is (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 122155919 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone |
| SMILES | Cc1ccc(F)c2c1CCCN2C(=O)c1csc(C2CCCO2)n1 |
| InChI | InChI=1S/C18H19FN2O2S/c1-11-6-7-13(19)16-12(11)4-2-8-21(16)18(22)14-10-24-17(20-14)15-5-3-9-23-15/h6-7,10,15H,2-5,8-9H2,1H3 |
| InChIKey | HFYWBGQOIWFMCP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone (CID 122155919) is (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone is Cc1ccc(F)c2c1CCCN2C(=O)c1csc(C2CCCO2)n1.
What is the InChIKey of (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone?
The InChIKey is HFYWBGQOIWFMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN2O2S/c1-11-6-7-13(19)16-12(11)4-2-8-21(16)18(22)14-10-24-17(20-14)15-5-3-9-23-15/h6-7,10,15H,2-5,8-9H2,1H3.
What are the key properties of (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone?
(8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone has a molecular weight of 346.43 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-fluoro-5-methyl-3,4-dihydro-2H-quinolin-1-yl)-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 122155919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).