C14H30N4O3S — CID 122156185
4-(2-methylpropyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboxamide (PubChem CID 122156185) has the molecular formula C14H30N4O3S and a molecular weight of 334.49 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-methylpropyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122156185 |
| Molecular Formula | C14H30N4O3S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-(2-methylpropyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboxamide |
| SMILES | CC(C)CN1CCN(C(=O)NCCS(=O)(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C14H30N4O3S/c1-12(2)11-17-6-8-18(9-7-17)14(19)15-5-10-22(20,21)16-13(3)4/h12-13,16H,5-11H2,1-4H3,(H,15,19) |
| InChIKey | LOPSJMSLUKCEMX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |