About 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride
2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride (PubChem CID 122156693) has the molecular formula C4H9ClF3NO2S
and a molecular weight of 227.63 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride |
| PubChem CID | 122156693 |
| Molecular Formula | C4H9ClF3NO2S |
| Molecular Weight | 227.63 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride |
| SMILES | Cl.NCCS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C4H8F3NO2S.ClH/c5-4(6,7)3-11(9,10)2-1-8;/h1-3,8H2;1H |
| InChIKey | SQQJGJGTBYSBMC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.63 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride?
The IUPAC name of 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride (CID 122156693) is 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride?
The canonical SMILES for 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride is Cl.NCCS(=O)(=O)CC(F)(F)F.
What is the InChIKey of 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride?
The InChIKey is SQQJGJGTBYSBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F3NO2S.ClH/c5-4(6,7)3-11(9,10)2-1-8;/h1-3,8H2;1H.
What are the key properties of 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride?
2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride has a molecular weight of 227.63 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethylsulfonyl)ethanamine;hydrochloride is sourced from PubChem (CID 122156693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).