C13H16BrFN2O2 — CID 122157400
4-bromo-N-[1-(2-fluoroethylamino)-1-oxopropan-2-yl]-2-methylbenzamide (PubChem CID 122157400) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 4-bromo-N-[1-(2-fluoroethylamino)-1-oxopropan-2-yl]-2-methylbenzamide.
| Compound Name | 4-bromo-N-[1-(2-fluoroethylamino)-1-oxopropan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 122157400 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-bromo-N-[1-(2-fluoroethylamino)-1-oxopropan-2-yl]-2-methylbenzamide |
| SMILES | Cc1cc(Br)ccc1C(=O)NC(C)C(=O)NCCF |
| InChI | InChI=1S/C13H16BrFN2O2/c1-8-7-10(14)3-4-11(8)13(19)17-9(2)12(18)16-6-5-15/h3-4,7,9H,5-6H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | MSPNLYPOJHKUPH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |