C18H21ClN4O — CID 122157779
N-[4-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]acetamide (PubChem CID 122157779) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is N-[4-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 122157779 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[4-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCN(c3ccc(Cl)cn3)CC2)cc1 |
| InChI | InChI=1S/C18H21ClN4O/c1-14(24)21-17-5-2-15(3-6-17)13-22-8-10-23(11-9-22)18-7-4-16(19)12-20-18/h2-7,12H,8-11,13H2,1H3,(H,21,24) |
| InChIKey | QULVWXABORKWJS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |