About (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone
(2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone (PubChem CID 122157942) has the molecular formula C16H25N3O2S
and a molecular weight of 323.46 g/mol. Its IUPAC name is (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone |
| PubChem CID | 122157942 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone |
| SMILES | Cc1nsc(NC2CC2)c1C(=O)N1CCOC(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H25N3O2S/c1-10-13(14(22-18-10)17-11-5-6-11)15(20)19-7-8-21-12(9-19)16(2,3)4/h11-12,17H,5-9H2,1-4H3 |
| InChIKey | WILGPDQLUWFKAO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone?
The IUPAC name of (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone (CID 122157942) is (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone.
What is the SMILES notation for (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone?
The canonical SMILES for (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone is Cc1nsc(NC2CC2)c1C(=O)N1CCOC(C(C)(C)C)C1.
What is the InChIKey of (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone?
The InChIKey is WILGPDQLUWFKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2S/c1-10-13(14(22-18-10)17-11-5-6-11)15(20)19-7-8-21-12(9-19)16(2,3)4/h11-12,17H,5-9H2,1-4H3.
What are the key properties of (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone?
(2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone has a molecular weight of 323.46 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylmorpholin-4-yl)-[5-(cyclopropylamino)-3-methyl-1,2-thiazol-4-yl]methanone is sourced from PubChem (CID 122157942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).