C17H22N4O — CID 122158640
1-(4-methoxy-2-pyridinyl)-4-(2-pyridin-4-ylethyl)piperazine (PubChem CID 122158640) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(4-methoxy-2-pyridinyl)-4-(2-pyridin-4-ylethyl)piperazine.
| Compound Name | 1-(4-methoxy-2-pyridinyl)-4-(2-pyridin-4-ylethyl)piperazine |
|---|---|
| PubChem CID | 122158640 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(4-methoxy-2-pyridinyl)-4-(2-pyridin-4-ylethyl)piperazine |
| SMILES | COc1ccnc(N2CCN(CCc3ccncc3)CC2)c1 |
| InChI | InChI=1S/C17H22N4O/c1-22-16-4-8-19-17(14-16)21-12-10-20(11-13-21)9-5-15-2-6-18-7-3-15/h2-4,6-8,14H,5,9-13H2,1H3 |
| InChIKey | WMSVKOIHEWNJAG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |