C15H15BrN2O2 — CID 122158945
N-[1-(3-bromophenyl)-2-hydroxyethyl]-2-pyridin-3-ylacetamide (PubChem CID 122158945) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)-2-hydroxyethyl]-2-pyridin-3-ylacetamide.
| Compound Name | N-[1-(3-bromophenyl)-2-hydroxyethyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 122158945 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-[1-(3-bromophenyl)-2-hydroxyethyl]-2-pyridin-3-ylacetamide |
| SMILES | O=C(Cc1cccnc1)NC(CO)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H15BrN2O2/c16-13-5-1-4-12(8-13)14(10-19)18-15(20)7-11-3-2-6-17-9-11/h1-6,8-9,14,19H,7,10H2,(H,18,20) |
| InChIKey | YDYUKTBSXPQJFY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |