C16H18N4O2 — CID 122159828
4-nitro-3-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)benzene-1,3-diamine (PubChem CID 122159828) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-nitro-3-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)benzene-1,3-diamine.
| Compound Name | 4-nitro-3-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 122159828 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-nitro-3-N-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)benzene-1,3-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])c(NCc2ccc3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C16H18N4O2/c17-12-6-8-16(20(21)22)15(9-12)18-10-13-7-5-11-3-1-2-4-14(11)19-13/h5-9,18H,1-4,10,17H2 |
| InChIKey | QUDFHTVKBAWPLE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|