C17H13N3O — CID 122160064
3-[[3-(1,3-oxazol-2-yl)anilino]methyl]benzonitrile (PubChem CID 122160064) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[[3-(1,3-oxazol-2-yl)anilino]methyl]benzonitrile.
| Compound Name | 3-[[3-(1,3-oxazol-2-yl)anilino]methyl]benzonitrile |
|---|---|
| PubChem CID | 122160064 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-[[3-(1,3-oxazol-2-yl)anilino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNc2cccc(-c3ncco3)c2)c1 |
| InChI | InChI=1S/C17H13N3O/c18-11-13-3-1-4-14(9-13)12-20-16-6-2-5-15(10-16)17-19-7-8-21-17/h1-10,20H,12H2 |
| InChIKey | BQUCGKMHBHHOSP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |