C19H21N3O3 — CID 122160074
2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-methoxyphenyl)-3-oxopropanamide (PubChem CID 122160074) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-methoxyphenyl)-3-oxopropanamide.
| Compound Name | 2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-methoxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 122160074 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-(2-methoxyphenyl)-3-oxopropanamide |
| SMILES | CCn1c(C)cc(C(=O)C(C#N)C(=O)Nc2ccccc2OC)c1C |
| InChI | InChI=1S/C19H21N3O3/c1-5-22-12(2)10-14(13(22)3)18(23)15(11-20)19(24)21-16-8-6-7-9-17(16)25-4/h6-10,15H,5H2,1-4H3,(H,21,24) |
| InChIKey | CYESIGSWPGZWKC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|