C13H17N3O3 — CID 122160609
6-cyclopropyl-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one (PubChem CID 122160609) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one.
| Compound Name | 6-cyclopropyl-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 122160609 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-cyclopropyl-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one |
| SMILES | O=C(Cn1nc(C2CC2)ccc1=O)N1CCOCC1 |
| InChI | InChI=1S/C13H17N3O3/c17-12-4-3-11(10-1-2-10)14-16(12)9-13(18)15-5-7-19-8-6-15/h3-4,10H,1-2,5-9H2 |
| InChIKey | JSIFGGGEWPSGKP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |