C13H17N7O2S — CID 122161043
2-(1-methyltetrazol-5-yl)sulfanyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone (PubChem CID 122161043) has the molecular formula C13H17N7O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 122161043 |
| Molecular Formula | C13H17N7O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
| SMILES | Cn1nnnc1SCC(=O)N1CCCC(Oc2ccncn2)C1 |
| InChI | InChI=1S/C13H17N7O2S/c1-19-13(16-17-18-19)23-8-12(21)20-6-2-3-10(7-20)22-11-4-5-14-9-15-11/h4-5,9-10H,2-3,6-8H2,1H3 |
| InChIKey | PUJVWTMOKRGFQS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |