C23H23N3O2 — CID 122161054
2,2-diphenyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone (PubChem CID 122161054) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2,2-diphenyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone.
| Compound Name | 2,2-diphenyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 122161054 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2,2-diphenyl-1-(3-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCCC(Oc2ccncn2)C1 |
| InChI | InChI=1S/C23H23N3O2/c27-23(22(18-8-3-1-4-9-18)19-10-5-2-6-11-19)26-15-7-12-20(16-26)28-21-13-14-24-17-25-21/h1-6,8-11,13-14,17,20,22H,7,12,15-16H2 |
| InChIKey | JZBLWBDKFVHRKH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |