C21H22N4O4S — CID 122161413
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-3-ylethyl]oxamide (PubChem CID 122161413) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-3-ylethyl]oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 122161413 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-3-ylethyl]oxamide |
| SMILES | Cc1cc(C)n(C(CNC(=O)C(=O)Nc2ccc3c(c2)OCCO3)c2ccsc2)n1 |
| InChI | InChI=1S/C21H22N4O4S/c1-13-9-14(2)25(24-13)17(15-5-8-30-12-15)11-22-20(26)21(27)23-16-3-4-18-19(10-16)29-7-6-28-18/h3-5,8-10,12,17H,6-7,11H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | BLRWDBYDMZAIQG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|