About N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide
N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide (PubChem CID 122161697) has the molecular formula C14H19N3O2S2
and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide |
| PubChem CID | 122161697 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide |
| SMILES | Cc1nn(CCNS(=O)(=O)C2CC2)c(C)c1-c1ccsc1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-10-14(12-5-8-20-9-12)11(2)17(16-10)7-6-15-21(18,19)13-3-4-13/h5,8-9,13,15H,3-4,6-7H2,1-2H3 |
| InChIKey | RHIJCRCUOMKPOA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide?
The IUPAC name of N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide (CID 122161697) is N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide.
What is the SMILES notation for N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide?
The canonical SMILES for N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide is Cc1nn(CCNS(=O)(=O)C2CC2)c(C)c1-c1ccsc1.
What is the InChIKey of N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide?
The InChIKey is RHIJCRCUOMKPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S2/c1-10-14(12-5-8-20-9-12)11(2)17(16-10)7-6-15-21(18,19)13-3-4-13/h5,8-9,13,15H,3-4,6-7H2,1-2H3.
What are the key properties of N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide?
N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide has a molecular weight of 325.46 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethyl-4-thiophen-3-ylpyrazol-1-yl)ethyl]cyclopropanesulfonamide is sourced from PubChem (CID 122161697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).