C15H17ClFN3O2S — CID 122161974
1-(3-chloro-4-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)piperidine (PubChem CID 122161974) has the molecular formula C15H17ClFN3O2S and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)piperidine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)piperidine |
|---|---|
| PubChem CID | 122161974 |
| Molecular Formula | C15H17ClFN3O2S |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)piperidine |
| SMILES | Cn1cc(C2CCCCN2S(=O)(=O)c2ccc(F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C15H17ClFN3O2S/c1-19-10-11(9-18-19)15-4-2-3-7-20(15)23(21,22)12-5-6-14(17)13(16)8-12/h5-6,8-10,15H,2-4,7H2,1H3 |
| InChIKey | XFTRELLIQWGXQZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |