C11H12N6O2S2 — CID 122162236
1-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]pyrazole-4-sulfonamide (PubChem CID 122162236) has the molecular formula C11H12N6O2S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is 1-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122162236 |
| Molecular Formula | C11H12N6O2S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-methyl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCc2cn(-c3ccsc3)nn2)cn1 |
| InChI | InChI=1S/C11H12N6O2S2/c1-16-7-11(5-12-16)21(18,19)13-4-9-6-17(15-14-9)10-2-3-20-8-10/h2-3,5-8,13H,4H2,1H3 |
| InChIKey | JPFVEOUFTRYFBF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |