About cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride
cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride (PubChem CID 122163519) has the molecular formula C4H8ClF2N
and a molecular weight of 143.56 g/mol. Its IUPAC name is cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride |
| PubChem CID | 122163519 |
| Molecular Formula | C4H8ClF2N |
| Molecular Weight | 143.56 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@@H]1C(F)F |
| InChI | InChI=1S/C4H7F2N.ClH/c5-4(6)2-1-3(2)7;/h2-4H,1,7H2;1H/t2-,3+;/m0./s1 |
| InChIKey | UYTDZEGHUBNTBD-LJUKVTEVSA-N |
| XLogP | 1.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride?
The IUPAC name of cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride (CID 122163519) is cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride.
What is the SMILES notation for cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride?
The canonical SMILES for cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride is Cl.N[C@@H]1C[C@@H]1C(F)F.
What is the InChIKey of cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride?
The InChIKey is UYTDZEGHUBNTBD-LJUKVTEVSA-N. The full InChI is InChI=1S/C4H7F2N.ClH/c5-4(6)2-1-3(2)7;/h2-4H,1,7H2;1H/t2-,3+;/m0./s1.
What are the key properties of cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride?
cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride has a molecular weight of 143.56 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 122163519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).