About (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride
(3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride (PubChem CID 122163562) has the molecular formula C6H14ClNO2
and a molecular weight of 167.64 g/mol. Its IUPAC name is (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride |
| PubChem CID | 122163562 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride |
| SMILES | COC[C@H]1C[C@@H](O)CN1.Cl |
| InChI | InChI=1S/C6H13NO2.ClH/c1-9-4-5-2-6(8)3-7-5;/h5-8H,2-4H2,1H3;1H/t5-,6-;/m1./s1 |
| InChIKey | KNMOZBOMDXHCKW-KGZKBUQUSA-N |
| XLogP | -0.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride?
The IUPAC name of (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride (CID 122163562) is (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride?
The canonical SMILES for (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride is COC[C@H]1C[C@@H](O)CN1.Cl.
What is the InChIKey of (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride?
The InChIKey is KNMOZBOMDXHCKW-KGZKBUQUSA-N. The full InChI is InChI=1S/C6H13NO2.ClH/c1-9-4-5-2-6(8)3-7-5;/h5-8H,2-4H2,1H3;1H/t5-,6-;/m1./s1.
What are the key properties of (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride?
(3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride has a molecular weight of 167.64 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 122163562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).