About 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride
3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride (PubChem CID 122163577) has the molecular formula C9H5ClN2O5S
and a molecular weight of 288.67 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride |
| PubChem CID | 122163577 |
| Molecular Formula | C9H5ClN2O5S |
| Molecular Weight | 288.67 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(S(=O)(=O)Cl)on2)cc1 |
| InChI | InChI=1S/C9H5ClN2O5S/c10-18(15,16)9-5-8(11-17-9)6-1-3-7(4-2-6)12(13)14/h1-5H |
| InChIKey | BTNNGVAJVKAKAP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride?
The IUPAC name of 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride (CID 122163577) is 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride.
What is the SMILES notation for 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride?
The canonical SMILES for 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride is O=[N+]([O-])c1ccc(-c2cc(S(=O)(=O)Cl)on2)cc1.
What is the InChIKey of 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride?
The InChIKey is BTNNGVAJVKAKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O5S/c10-18(15,16)9-5-8(11-17-9)6-1-3-7(4-2-6)12(13)14/h1-5H.
What are the key properties of 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride?
3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride has a molecular weight of 288.67 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-nitrophenyl)-1,2-oxazole-5-sulfonyl chloride is sourced from PubChem (CID 122163577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).