C9H22Cl2N2O2 — CID 122163592
N,N-bis(2-methoxyethyl)azetidin-3-amine;dihydrochloride (PubChem CID 122163592) has the molecular formula C9H22Cl2N2O2 and a molecular weight of 261.19 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)azetidin-3-amine;dihydrochloride.
| Compound Name | N,N-bis(2-methoxyethyl)azetidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 122163592 |
| Molecular Formula | C9H22Cl2N2O2 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N,N-bis(2-methoxyethyl)azetidin-3-amine;dihydrochloride |
| SMILES | COCCN(CCOC)C1CNC1.Cl.Cl |
| InChI | InChI=1S/C9H20N2O2.2ClH/c1-12-5-3-11(4-6-13-2)9-7-10-8-9;;/h9-10H,3-8H2,1-2H3;2*1H |
| InChIKey | BRFNYERFKFFCGW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |