methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate

C10H12N2O2 — CID 122163606

IUPACmethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate
SMILESCOC(=O)c1ccc2c(n1)CCCN2
InChIInChI=1S/C10H12N2O2/c1-14-10(13)9-5-4-7-8(12-9)3-2-6-11-7/h4-5,11H,2-3,6H2,1H3
InChIKeyVLRDCSSYGUUCMF-UHFFFAOYSA-N
MW192.22 g/mol
LogP1.23
Rot. Bonds1

About methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate

methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate (PubChem CID 122163606) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate
PubChem CID122163606
Molecular FormulaC10H12N2O2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Namemethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate
SMILESCOC(=O)c1ccc2c(n1)CCCN2
InChIInChI=1S/C10H12N2O2/c1-14-10(13)9-5-4-7-8(12-9)3-2-6-11-7/h4-5,11H,2-3,6H2,1H3
InChIKeyVLRDCSSYGUUCMF-UHFFFAOYSA-N
XLogP1.23
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 51.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate?
The IUPAC name of methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate (CID 122163606) is methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate.
What is the SMILES notation for methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate?
The canonical SMILES for methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate is COC(=O)c1ccc2c(n1)CCCN2.
What is the InChIKey of methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate?
The InChIKey is VLRDCSSYGUUCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-14-10(13)9-5-4-7-8(12-9)3-2-6-11-7/h4-5,11H,2-3,6H2,1H3.
What are the key properties of methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate?
methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate has a molecular weight of 192.22 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carboxylate is sourced from PubChem (CID 122163606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).