About (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate
(4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate (PubChem CID 122163638) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate |
| PubChem CID | 122163638 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1noc(C)c1C |
| InChI | InChI=1S/C7H10N2O3/c1-4-5(2)12-9-6(4)11-7(10)8-3/h1-3H3,(H,8,10) |
| InChIKey | QXLHLIHPXLVPDA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate?
The IUPAC name of (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate (CID 122163638) is (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate.
What is the SMILES notation for (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate?
The canonical SMILES for (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate is CNC(=O)Oc1noc(C)c1C.
What is the InChIKey of (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate?
The InChIKey is QXLHLIHPXLVPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-4-5(2)12-9-6(4)11-7(10)8-3/h1-3H3,(H,8,10).
What are the key properties of (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate?
(4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate has a molecular weight of 170.17 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1,2-oxazol-3-yl) N-methylcarbamate is sourced from PubChem (CID 122163638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).