C12H19NO2 — CID 122163681
tert-butyl 5-azaspiro[3.4]oct-7-ene-5-carboxylate (PubChem CID 122163681) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is tert-butyl 5-azaspiro[3.4]oct-7-ene-5-carboxylate.
| Compound Name | tert-butyl 5-azaspiro[3.4]oct-7-ene-5-carboxylate |
|---|---|
| PubChem CID | 122163681 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | tert-butyl 5-azaspiro[3.4]oct-7-ene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC12CCC2 |
| InChI | InChI=1S/C12H19NO2/c1-11(2,3)15-10(14)13-9-5-8-12(13)6-4-7-12/h5,8H,4,6-7,9H2,1-3H3 |
| InChIKey | WXVRXFBFOUAZMD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|